C19H21N3O7S — CID 172926530
propan-2-yl 2-[2-methoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 172926530) has the molecular formula C19H21N3O7S and a molecular weight of 435.46 g/mol. Its IUPAC name is propan-2-yl 2-[2-methoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[2-methoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 172926530 |
| Molecular Formula | C19H21N3O7S |
| Molecular Weight | 435.46 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | propan-2-yl 2-[2-methoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OCC(=O)OC(C)C)c(OC)c2)NC1=O |
| InChI | InChI=1S/C19H21N3O7S/c1-11(2)29-17(24)10-28-13-6-5-12(7-14(13)26-3)9-20-22-19-21-18(25)15(30-19)8-16(23)27-4/h5-9,11H,10H2,1-4H3,(H,21,22,25)/b15-8+,20-9? |
| InChIKey | TYSHFBROCZEVSI-MUKYNNQYSA-N |
| XLogP | 1.64 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|