C17H13F6N3O5S — CID 172926236
methyl (2E)-2-[(2Z)-2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926236) has the molecular formula C17H13F6N3O5S and a molecular weight of 485.36 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926236 |
| Molecular Formula | C17H13F6N3O5S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[[4-(1,1,2,3,3,3-hexafluoropropoxy)-3-methoxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2ccc(OC(F)(F)C(F)C(F)(F)F)c(OC)c2)NC1=O |
| InChI | InChI=1S/C17H13F6N3O5S/c1-29-10-5-8(3-4-9(10)31-17(22,23)14(18)16(19,20)21)7-24-26-15-25-13(28)11(32-15)6-12(27)30-2/h3-7,14H,1-2H3,(H,25,26,28)/b11-6+,24-7? |
| InChIKey | LDHSPUZKUYXOFK-MHTRYSDRSA-N |
| XLogP | 3.18 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|