C19H20BrN3O7S — CID 172926511
methyl 2-[2-bromo-6-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoate (PubChem CID 172926511) has the molecular formula C19H20BrN3O7S and a molecular weight of 514.35 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoate.
| Compound Name | methyl 2-[2-bromo-6-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 172926511 |
| Molecular Formula | C19H20BrN3O7S |
| Molecular Weight | 514.35 g/mol |
| Exact Mass | 513.02 |
| IUPAC Name | methyl 2-[2-bromo-6-ethoxy-4-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]propanoate |
| SMILES | CCOc1cc(C=N/N=C2/NC(=O)/C(=C\C(=O)OC)S2)cc(Br)c1OC(C)C(=O)OC |
| InChI | InChI=1S/C19H20BrN3O7S/c1-5-29-13-7-11(6-12(20)16(13)30-10(2)18(26)28-4)9-21-23-19-22-17(25)14(31-19)8-15(24)27-3/h6-10H,5H2,1-4H3,(H,22,23,25)/b14-8+,21-9? |
| InChIKey | MOFDFYOWVDYSFW-AFVLGWRRSA-N |
| XLogP | 2.40 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|