C14H14BN3O6S — CID 172924586
[4-methoxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid (PubChem CID 172924586) has the molecular formula C14H14BN3O6S and a molecular weight of 363.16 g/mol. Its IUPAC name is [4-methoxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid.
| Compound Name | [4-methoxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 172924586 |
| Molecular Formula | C14H14BN3O6S |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | [4-methoxy-3-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenyl]boronic acid |
| SMILES | COC(=O)/C=C1/S/C(=N\N=Cc2cc(B(O)O)ccc2OC)NC1=O |
| InChI | InChI=1S/C14H14BN3O6S/c1-23-10-4-3-9(15(21)22)5-8(10)7-16-18-14-17-13(20)11(25-14)6-12(19)24-2/h3-7,21-22H,1-2H3,(H,17,18,20)/b11-6+,16-7? |
| InChIKey | CNJRZELAFXTHGN-DFUWENOTSA-N |
| XLogP | -1.02 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|