C16H15Br2N3O4S — CID 172926441
methyl (2E)-2-[(2Z)-2-[(3,5-dibromo-2-propoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 172926441) has the molecular formula C16H15Br2N3O4S and a molecular weight of 505.19 g/mol. Its IUPAC name is methyl (2E)-2-[(2Z)-2-[(3,5-dibromo-2-propoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2Z)-2-[(3,5-dibromo-2-propoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 172926441 |
| Molecular Formula | C16H15Br2N3O4S |
| Molecular Weight | 505.19 g/mol |
| Exact Mass | 502.92 |
| IUPAC Name | methyl (2E)-2-[(2Z)-2-[(3,5-dibromo-2-propoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | CCCOc1c(Br)cc(Br)cc1C=N/N=C1/NC(=O)/C(=C\C(=O)OC)S1 |
| InChI | InChI=1S/C16H15Br2N3O4S/c1-3-4-25-14-9(5-10(17)6-11(14)18)8-19-21-16-20-15(23)12(26-16)7-13(22)24-2/h5-8H,3-4H2,1-2H3,(H,20,21,23)/b12-7+,19-8? |
| InChIKey | KOZZCNATJAGIDK-SXYUJBPUSA-N |
| XLogP | 3.61 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|