C17H15BrFN3O6S — CID 172926849
ethyl 2-[4-bromo-2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 172926849) has the molecular formula C17H15BrFN3O6S and a molecular weight of 488.29 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-bromo-2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 172926849 |
| Molecular Formula | C17H15BrFN3O6S |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 486.98 |
| IUPAC Name | ethyl 2-[4-bromo-2-fluoro-6-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(F)cc(Br)cc1C=N/N=C1/NC(=O)/C(=C\C(=O)OC)S1 |
| InChI | InChI=1S/C17H15BrFN3O6S/c1-3-27-14(24)8-28-15-9(4-10(18)5-11(15)19)7-20-22-17-21-16(25)12(29-17)6-13(23)26-2/h4-7H,3,8H2,1-2H3,(H,21,22,25)/b12-6+,20-7? |
| InChIKey | GXEOLNMLKHKGRX-ORPSDHOSSA-N |
| XLogP | 2.14 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|