C23H23N5O4 — CID 110341184
2-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]-N-(4-phenoxyphenyl)acetamide (PubChem CID 110341184) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 110341184 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[4-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxyphenoxy]-N-(4-phenoxyphenyl)acetamide |
| SMILES | COc1cc(/C=N/N=C(N)N)ccc1OCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N5O4/c1-30-21-13-16(14-26-28-23(24)25)7-12-20(21)31-15-22(29)27-17-8-10-19(11-9-17)32-18-5-3-2-4-6-18/h2-14H,15H2,1H3,(H,27,29)(H4,24,25,28)/b26-14+ |
| InChIKey | JTKXYIFWHCSHCM-VULFUBBASA-N |
| XLogP | 3.11 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|