C28H26N2O4 — CID 126273736
2-[2-methoxy-4-[(4-phenoxyanilino)methyl]phenoxy]-N-phenylacetamide (PubChem CID 126273736) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(4-phenoxyanilino)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-methoxy-4-[(4-phenoxyanilino)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126273736 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 2-[2-methoxy-4-[(4-phenoxyanilino)methyl]phenoxy]-N-phenylacetamide |
| SMILES | COc1cc(CNc2ccc(Oc3ccccc3)cc2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H26N2O4/c1-32-27-18-21(12-17-26(27)33-20-28(31)30-23-8-4-2-5-9-23)19-29-22-13-15-25(16-14-22)34-24-10-6-3-7-11-24/h2-18,29H,19-20H2,1H3,(H,30,31) |
| InChIKey | NYIGNICGYMPPFA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |