C22H21ClN2O3 — CID 2986546
2-[4-[(3-chloroanilino)methyl]-2-methoxyphenoxy]-N-phenylacetamide (PubChem CID 2986546) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 2-[4-[(3-chloroanilino)methyl]-2-methoxyphenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(3-chloroanilino)methyl]-2-methoxyphenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 2986546 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[4-[(3-chloroanilino)methyl]-2-methoxyphenoxy]-N-phenylacetamide |
| SMILES | COc1cc(CNc2cccc(Cl)c2)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H21ClN2O3/c1-27-21-12-16(14-24-19-9-5-6-17(23)13-19)10-11-20(21)28-15-22(26)25-18-7-3-2-4-8-18/h2-13,24H,14-15H2,1H3,(H,25,26) |
| InChIKey | LIMZBVSPZWZRNT-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |