C24H26N2O3 — CID 126382591
2-[4-(anilinomethyl)-2-methoxyphenoxy]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 126382591) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-[4-(anilinomethyl)-2-methoxyphenoxy]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(anilinomethyl)-2-methoxyphenoxy]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126382591 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[4-(anilinomethyl)-2-methoxyphenoxy]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(CNc2ccccc2)ccc1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C24H26N2O3/c1-17-9-11-21(18(2)13-17)26-24(27)16-29-22-12-10-19(14-23(22)28-3)15-25-20-7-5-4-6-8-20/h4-14,25H,15-16H2,1-3H3,(H,26,27) |
| InChIKey | LMFKVNHEPBFCTB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |