C18H18N4O6 — CID 19617899
4-[[2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]acetyl]amino]benzoic acid (PubChem CID 19617899) has the molecular formula C18H18N4O6 and a molecular weight of 386.36 g/mol. Its IUPAC name is 4-[[2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 19617899 |
| Molecular Formula | C18H18N4O6 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 4-[[2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]acetyl]amino]benzoic acid |
| SMILES | COc1cc(/C=N/NC(N)=O)ccc1OCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H18N4O6/c1-27-15-8-11(9-20-22-18(19)26)2-7-14(15)28-10-16(23)21-13-5-3-12(4-6-13)17(24)25/h2-9H,10H2,1H3,(H,21,23)(H,24,25)(H3,19,22,26)/b20-9+ |
| InChIKey | PCMWYPADOTXGOP-AWQFTUOYSA-N |
| XLogP | 1.41 |
| TPSA | 152.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|