C24H23N3O5 — CID 45466645
4-[(2E)-2-[[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid (PubChem CID 45466645) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is 4-[(2E)-2-[[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[(2E)-2-[[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 45466645 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[(2E)-2-[[3-methoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]hydrazinyl]benzoic acid |
| SMILES | COc1cc(/C=N/Nc2ccc(C(=O)O)cc2)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H23N3O5/c1-16-3-8-19(9-4-16)26-23(28)15-32-21-12-5-17(13-22(21)31-2)14-25-27-20-10-6-18(7-11-20)24(29)30/h3-14,27H,15H2,1-2H3,(H,26,28)(H,29,30)/b25-14+ |
| InChIKey | JNVXKLRXCBOGIP-AFUMVMLFSA-N |
| XLogP | 4.17 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|