C24H24ClN3O3 — CID 110842433
2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 110842433) has the molecular formula C24H24ClN3O3 and a molecular weight of 437.93 g/mol. Its IUPAC name is 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 110842433 |
| Molecular Formula | C24H24ClN3O3 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | COc1cc(C=NNc2ccc(C)c(Cl)c2)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C24H24ClN3O3/c1-16-4-8-19(9-5-16)27-24(29)15-31-22-11-7-18(12-23(22)30-3)14-26-28-20-10-6-17(2)21(25)13-20/h4-14,28H,15H2,1-3H3,(H,27,29) |
| InChIKey | RLSDVPVHGUEKKJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|