C23H30ClN3O3 — CID 110842509
2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-dipropylacetamide (PubChem CID 110842509) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-dipropylacetamide.
| Compound Name | 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-dipropylacetamide |
|---|---|
| PubChem CID | 110842509 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[4-[[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-2-methoxyphenoxy]-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)COc1ccc(C=NNc2ccc(C)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C23H30ClN3O3/c1-5-11-27(12-6-2)23(28)16-30-21-10-8-18(13-22(21)29-4)15-25-26-19-9-7-17(3)20(24)14-19/h7-10,13-15,26H,5-6,11-12,16H2,1-4H3 |
| InChIKey | OCUWJOUXRKURKB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|