C19H21BrClN3O3 — CID 42996797
2-[2-bromo-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]-N,N-dimethylacetamide (PubChem CID 42996797) has the molecular formula C19H21BrClN3O3 and a molecular weight of 454.75 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-bromo-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 42996797 |
| Molecular Formula | C19H21BrClN3O3 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[(3-chloro-4-methylphenyl)hydrazinylidene]methyl]-6-methoxyphenoxy]-N,N-dimethylacetamide |
| SMILES | COc1cc(/C=N/Nc2ccc(C)c(Cl)c2)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C19H21BrClN3O3/c1-12-5-6-14(9-16(12)21)23-22-10-13-7-15(20)19(17(8-13)26-4)27-11-18(25)24(2)3/h5-10,23H,11H2,1-4H3/b22-10+ |
| InChIKey | ZJRJVFVRVPEWBX-LSHDLFTRSA-N |
| XLogP | 4.33 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|