C18H18BrF3N4O3 — CID 4856004
2-[2-bromo-6-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 4856004) has the molecular formula C18H18BrF3N4O3 and a molecular weight of 475.27 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-bromo-6-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 4856004 |
| Molecular Formula | C18H18BrF3N4O3 |
| Molecular Weight | 475.27 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[[[5-(trifluoromethyl)-2-pyridinyl]hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | COc1cc(C=NNc2ccc(C(F)(F)F)cn2)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C18H18BrF3N4O3/c1-26(2)16(27)10-29-17-13(19)6-11(7-14(17)28-3)8-24-25-15-5-4-12(9-23-15)18(20,21)22/h4-9H,10H2,1-3H3,(H,23,25) |
| InChIKey | YZXSJEPGOPGOQS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|