C16H16BrN3O4 — CID 110505773
6-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid (PubChem CID 110505773) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is 6-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 110505773 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 6-[(2E)-2-[(3-bromo-4-ethoxy-5-methoxyphenyl)methylidene]hydrazinyl]pyridine-3-carboxylic acid |
| SMILES | CCOc1c(Br)cc(/C=N/Nc2ccc(C(=O)O)cn2)cc1OC |
| InChI | InChI=1S/C16H16BrN3O4/c1-3-24-15-12(17)6-10(7-13(15)23-2)8-19-20-14-5-4-11(9-18-14)16(21)22/h4-9H,3H2,1-2H3,(H,18,20)(H,21,22)/b19-8+ |
| InChIKey | MJAPIHZQYBTTIL-UFWORHAWSA-N |
| XLogP | 3.40 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|