C18H19BrN2O4 — CID 110841167
4-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]benzoic acid (PubChem CID 110841167) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is 4-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]benzoic acid.
| Compound Name | 4-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
|---|---|
| PubChem CID | 110841167 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 4-[2-[(3-bromo-4,5-diethoxyphenyl)methylidene]hydrazinyl]benzoic acid |
| SMILES | CCOc1cc(C=NNc2ccc(C(=O)O)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C18H19BrN2O4/c1-3-24-16-10-12(9-15(19)17(16)25-4-2)11-20-21-14-7-5-13(6-8-14)18(22)23/h5-11,21H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | MVTCOMIXCBFCMO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|