C17H17BrCl2N2O2 — CID 110840568
N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-3,4-dichloroaniline (PubChem CID 110840568) has the molecular formula C17H17BrCl2N2O2 and a molecular weight of 432.15 g/mol. Its IUPAC name is N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-3,4-dichloroaniline.
| Compound Name | N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-3,4-dichloroaniline |
|---|---|
| PubChem CID | 110840568 |
| Molecular Formula | C17H17BrCl2N2O2 |
| Molecular Weight | 432.15 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | N-[(3-bromo-4,5-diethoxyphenyl)methylideneamino]-3,4-dichloroaniline |
| SMILES | CCOc1cc(C=NNc2ccc(Cl)c(Cl)c2)cc(Br)c1OCC |
| InChI | InChI=1S/C17H17BrCl2N2O2/c1-3-23-16-8-11(7-13(18)17(16)24-4-2)10-21-22-12-5-6-14(19)15(20)9-12/h5-10,22H,3-4H2,1-2H3 |
| InChIKey | JRKQYBSVPLTWCP-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.15 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|