C18H18BrN3O2S — CID 110510809
N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 110510809) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 110510809 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2nc3ccccc3s2)cc(Br)c1OCC |
| InChI | InChI=1S/C18H18BrN3O2S/c1-3-23-15-10-12(9-13(19)17(15)24-4-2)11-20-22-18-21-14-7-5-6-8-16(14)25-18/h5-11H,3-4H2,1-2H3,(H,21,22)/b20-11- |
| InChIKey | LBGRZPBAUYVSED-JAIQZWGSSA-N |
| XLogP | 5.30 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|