C16H18BrN3O2S — CID 168618411
N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618411) has the molecular formula C16H18BrN3O2S and a molecular weight of 396.31 g/mol. Its IUPAC name is N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618411 |
| Molecular Formula | C16H18BrN3O2S |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | N-[(3-bromo-5-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | C=CCOc1c(Br)cc(C=NNc2nc(C)cs2)cc1OCC |
| InChI | InChI=1S/C16H18BrN3O2S/c1-4-6-22-15-13(17)7-12(8-14(15)21-5-2)9-18-20-16-19-11(3)10-23-16/h4,7-10H,1,5-6H2,2-3H3,(H,19,20) |
| InChIKey | WGXNDAKRPADJDX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|