C16H21N3O3S — CID 110536776
N-[(Z)-(3,5-dimethoxy-4-propoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 110536776) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[(Z)-(3,5-dimethoxy-4-propoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(Z)-(3,5-dimethoxy-4-propoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110536776 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[(Z)-(3,5-dimethoxy-4-propoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCOc1c(OC)cc(/C=N\Nc2nc(C)cs2)cc1OC |
| InChI | InChI=1S/C16H21N3O3S/c1-5-6-22-15-13(20-3)7-12(8-14(15)21-4)9-17-19-16-18-11(2)10-23-16/h7-10H,5-6H2,1-4H3,(H,18,19)/b17-9- |
| InChIKey | XWEDMOONUUIDAI-MFOYZWKCSA-N |
| XLogP | 3.70 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|