C17H22BrN3O2S — CID 168618778
N-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618778) has the molecular formula C17H22BrN3O2S and a molecular weight of 412.35 g/mol. Its IUPAC name is N-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618778 |
| Molecular Formula | C17H22BrN3O2S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCOc1c(Br)cc(C=NNc2nc(C)cs2)cc1OCC |
| InChI | InChI=1S/C17H22BrN3O2S/c1-4-6-7-23-16-14(18)8-13(9-15(16)22-5-2)10-19-21-17-20-12(3)11-24-17/h8-11H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | WHZBEBQCGYLHFU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|