C16H20FN3OS — CID 168617263
N-[(4-fluoro-3-pentoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168617263) has the molecular formula C16H20FN3OS and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(4-fluoro-3-pentoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[(4-fluoro-3-pentoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168617263 |
| Molecular Formula | C16H20FN3OS |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | N-[(4-fluoro-3-pentoxyphenyl)methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1cc(C=NNc2nc(C)cs2)ccc1F |
| InChI | InChI=1S/C16H20FN3OS/c1-3-4-5-8-21-15-9-13(6-7-14(15)17)10-18-20-16-19-12(2)11-22-16/h6-7,9-11H,3-5,8H2,1-2H3,(H,19,20) |
| InChIKey | SZJVFXRJXNYJBC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|