C13H11Br2N3O2S — CID 168618658
[2,6-dibromo-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate (PubChem CID 168618658) has the molecular formula C13H11Br2N3O2S and a molecular weight of 433.13 g/mol. Its IUPAC name is [2,6-dibromo-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dibromo-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 168618658 |
| Molecular Formula | C13H11Br2N3O2S |
| Molecular Weight | 433.13 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | [2,6-dibromo-4-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1c(Br)cc(C=NNc2nc(C)cs2)cc1Br |
| InChI | InChI=1S/C13H11Br2N3O2S/c1-7-6-21-13(17-7)18-16-5-9-3-10(14)12(11(15)4-9)20-8(2)19/h3-6H,1-2H3,(H,17,18) |
| InChIKey | LKASTTSCSPIXNK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.13 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|