C11H9Br2N3OS — CID 2791064
2,4-dibromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 2791064) has the molecular formula C11H9Br2N3OS and a molecular weight of 391.09 g/mol. Its IUPAC name is 2,4-dibromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2,4-dibromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 2791064 |
| Molecular Formula | C11H9Br2N3OS |
| Molecular Weight | 391.09 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 2,4-dibromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1csc(NN=Cc2cc(Br)cc(Br)c2O)n1 |
| InChI | InChI=1S/C11H9Br2N3OS/c1-6-5-18-11(15-6)16-14-4-7-2-8(12)3-9(13)10(7)17/h2-5,17H,1H3,(H,15,16) |
| InChIKey | FQHWOCATHJGPPA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.09 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|