C13H14ClN3OS — CID 168619492
2-(chloromethyl)-4-methyl-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 168619492) has the molecular formula C13H14ClN3OS and a molecular weight of 295.80 g/mol. Its IUPAC name is 2-(chloromethyl)-4-methyl-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 2-(chloromethyl)-4-methyl-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 168619492 |
| Molecular Formula | C13H14ClN3OS |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-(chloromethyl)-4-methyl-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1cc(C=NNc2nc(C)cs2)c(O)c(CCl)c1 |
| InChI | InChI=1S/C13H14ClN3OS/c1-8-3-10(5-14)12(18)11(4-8)6-15-17-13-16-9(2)7-19-13/h3-4,6-7,18H,5H2,1-2H3,(H,16,17) |
| InChIKey | KWPRBRUUGQWRPE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|