C12H9BrF3N3OS — CID 168619700
2-bromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(trifluoromethyl)phenol (PubChem CID 168619700) has the molecular formula C12H9BrF3N3OS and a molecular weight of 380.19 g/mol. Its IUPAC name is 2-bromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(trifluoromethyl)phenol.
| Compound Name | 2-bromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 168619700 |
| Molecular Formula | C12H9BrF3N3OS |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 2-bromo-6-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-(trifluoromethyl)phenol |
| SMILES | Cc1csc(NN=Cc2cc(C(F)(F)F)cc(Br)c2O)n1 |
| InChI | InChI=1S/C12H9BrF3N3OS/c1-6-5-21-11(18-6)19-17-4-7-2-8(12(14,15)16)3-9(13)10(7)20/h2-5,20H,1H3,(H,18,19) |
| InChIKey | ZCNVIKCJPQEQMJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|