C11H10IN3OS — CID 168618025
4-iodo-3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 168618025) has the molecular formula C11H10IN3OS and a molecular weight of 359.19 g/mol. Its IUPAC name is 4-iodo-3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-iodo-3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 168618025 |
| Molecular Formula | C11H10IN3OS |
| Molecular Weight | 359.19 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 4-iodo-3-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1csc(NN=Cc2cc(O)ccc2I)n1 |
| InChI | InChI=1S/C11H10IN3OS/c1-7-6-17-11(14-7)15-13-5-8-4-9(16)2-3-10(8)12/h2-6,16H,1H3,(H,14,15) |
| InChIKey | ORVHODHKMDSXAW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|