C11H10Br2N4OS — CID 168626422
6-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,4-dibromo-3-methylphenol (PubChem CID 168626422) has the molecular formula C11H10Br2N4OS and a molecular weight of 406.10 g/mol. Its IUPAC name is 6-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,4-dibromo-3-methylphenol.
| Compound Name | 6-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,4-dibromo-3-methylphenol |
|---|---|
| PubChem CID | 168626422 |
| Molecular Formula | C11H10Br2N4OS |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.89 |
| IUPAC Name | 6-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2,4-dibromo-3-methylphenol |
| SMILES | Cc1c(Br)cc(C=NNc2nc(N)cs2)c(O)c1Br |
| InChI | InChI=1S/C11H10Br2N4OS/c1-5-7(12)2-6(10(18)9(5)13)3-15-17-11-16-8(14)4-19-11/h2-4,18H,14H2,1H3,(H,16,17) |
| InChIKey | SRSNYGXISMNBFP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|