C11H11N5O4S — CID 168626377
2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-methoxy-6-nitrophenol (PubChem CID 168626377) has the molecular formula C11H11N5O4S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-methoxy-6-nitrophenol.
| Compound Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-methoxy-6-nitrophenol |
|---|---|
| PubChem CID | 168626377 |
| Molecular Formula | C11H11N5O4S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-4-methoxy-6-nitrophenol |
| SMILES | COc1cc(C=NNc2nc(N)cs2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N5O4S/c1-20-7-2-6(10(17)8(3-7)16(18)19)4-13-15-11-14-9(12)5-21-11/h2-5,17H,12H2,1H3,(H,14,15) |
| InChIKey | DTEZZVJDDNLQQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|