C12H12N6O3S — CID 168628252
N-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]acetamide (PubChem CID 168628252) has the molecular formula C12H12N6O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is N-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]acetamide.
| Compound Name | N-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 168628252 |
| Molecular Formula | C12H12N6O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-nitrophenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C=NNc2nc(N)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N6O3S/c1-7(19)15-9-3-2-8(4-10(9)18(20)21)5-14-17-12-16-11(13)6-22-12/h2-6H,13H2,1H3,(H,15,19)(H,16,17) |
| InChIKey | NFKKFDKIOSWSEG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|