C11H8F3N5O3S — CID 168628370
2-N-[[3-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168628370) has the molecular formula C11H8F3N5O3S and a molecular weight of 347.28 g/mol. Its IUPAC name is 2-N-[[3-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168628370 |
| Molecular Formula | C11H8F3N5O3S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-N-[[3-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc(OC(F)(F)F)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H8F3N5O3S/c12-11(13,14)22-8-2-1-6(3-7(8)19(20)21)4-16-18-10-17-9(15)5-23-10/h1-5H,15H2,(H,17,18) |
| InChIKey | SYJLAKVLDWZVCG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|