C17H14N6O6S — CID 168627486
2-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627486) has the molecular formula C17H14N6O6S and a molecular weight of 430.40 g/mol. Its IUPAC name is 2-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627486 |
| Molecular Formula | C17H14N6O6S |
| Molecular Weight | 430.40 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-N-[[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | COc1cc(C=NNc2nc(N)cs2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N6O6S/c1-28-15-6-10(8-19-21-17-20-16(18)9-30-17)2-4-14(15)29-13-5-3-11(22(24)25)7-12(13)23(26)27/h2-9H,18H2,1H3,(H,20,21) |
| InChIKey | KEDBMGZFOYAPNG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 168.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|