C17H13N5O5S — CID 168618863
N-[[2-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine (PubChem CID 168618863) has the molecular formula C17H13N5O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is N-[[2-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-[[2-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 168618863 |
| Molecular Formula | C17H13N5O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[[2-(2,4-dinitrophenoxy)phenyl]methylideneamino]-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NN=Cc2ccccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H13N5O5S/c1-11-10-28-17(19-11)20-18-9-12-4-2-3-5-15(12)27-16-7-6-13(21(23)24)8-14(16)22(25)26/h2-10H,1H3,(H,19,20) |
| InChIKey | KGWMIZNGRQWNSM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 132.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|