C12H10N4S — CID 168616860
2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzonitrile (PubChem CID 168616860) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzonitrile.
| Compound Name | 2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 168616860 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-[[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzonitrile |
| SMILES | Cc1csc(NN=Cc2ccccc2C#N)n1 |
| InChI | InChI=1S/C12H10N4S/c1-9-8-17-12(15-9)16-14-7-11-5-3-2-4-10(11)6-13/h2-5,7-8H,1H3,(H,15,16) |
| InChIKey | FTXAZBJVNHZDNF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|