C16H12N6O5S — CID 168627399
2-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168627399) has the molecular formula C16H12N6O5S and a molecular weight of 400.38 g/mol. Its IUPAC name is 2-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168627399 |
| Molecular Formula | C16H12N6O5S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 2-N-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H12N6O5S/c17-15-9-28-16(19-15)20-18-8-10-2-1-3-12(6-10)27-14-5-4-11(21(23)24)7-13(14)22(25)26/h1-9H,17H2,(H,19,20) |
| InChIKey | IEZAYTWVZCJZIO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|