C26H24N10O7 — CID 171981507
4-N-[(E)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-N,2-N-diethyl-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 171981507) has the molecular formula C26H24N10O7 and a molecular weight of 588.54 g/mol. Its IUPAC name is 4-N-[(E)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-N,2-N-diethyl-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[(E)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-N,2-N-diethyl-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171981507 |
| Molecular Formula | C26H24N10O7 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 4-N-[(E)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2-N,2-N-diethyl-6-N-(4-nitrophenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N/N=C/c2cccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)nc(Nc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C26H24N10O7/c1-3-33(4-2)26-30-24(28-18-8-10-19(11-9-18)34(37)38)29-25(31-26)32-27-16-17-6-5-7-21(14-17)43-23-13-12-20(35(39)40)15-22(23)36(41)42/h5-16H,3-4H2,1-2H3,(H2,28,29,30,31,32)/b27-16+ |
| InChIKey | QDZMBYUXKXTACM-JVWAILMASA-N |
| XLogP | 5.42 |
| TPSA | 216.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|