C19H9F5N4O5 — CID 6257662
N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline (PubChem CID 6257662) has the molecular formula C19H9F5N4O5 and a molecular weight of 468.29 g/mol. Its IUPAC name is N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline.
| Compound Name | N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
|---|---|
| PubChem CID | 6257662 |
| Molecular Formula | C19H9F5N4O5 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-[(Z)-[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]-2,3,4,5,6-pentafluoroaniline |
| SMILES | O=[N+]([O-])c1ccc(Oc2cccc(/C=N\Nc3c(F)c(F)c(F)c(F)c3F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H9F5N4O5/c20-14-15(21)17(23)19(18(24)16(14)22)26-25-8-9-2-1-3-11(6-9)33-13-5-4-10(27(29)30)7-12(13)28(31)32/h1-8,26H/b25-8- |
| InChIKey | BLIZNDVFJGSLLX-JAHAZDFLSA-N |
| XLogP | 5.44 |
| TPSA | 119.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|