C14H12N6O5 — CID 168592206
2-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]guanidine (PubChem CID 168592206) has the molecular formula C14H12N6O5 and a molecular weight of 344.29 g/mol. Its IUPAC name is 2-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168592206 |
| Molecular Formula | C14H12N6O5 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[[3-(2,4-dinitrophenoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N6O5/c15-14(16)18-17-8-9-2-1-3-11(6-9)25-13-5-4-10(19(21)22)7-12(13)20(23)24/h1-8H,(H4,15,16,18) |
| InChIKey | QZZGIIHDABXHSG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 172.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|