C14H12N2O6 — CID 52506797
(1S)-1-[3-(2,4-dinitrophenoxy)phenyl]ethanol (PubChem CID 52506797) has the molecular formula C14H12N2O6 and a molecular weight of 304.26 g/mol. Its IUPAC name is (1S)-1-[3-(2,4-dinitrophenoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[3-(2,4-dinitrophenoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 52506797 |
| Molecular Formula | C14H12N2O6 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (1S)-1-[3-(2,4-dinitrophenoxy)phenyl]ethanol |
| SMILES | C[C@H](O)c1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O6/c1-9(17)10-3-2-4-12(7-10)22-14-6-5-11(15(18)19)8-13(14)16(20)21/h2-9,17H,1H3/t9-/m0/s1 |
| InChIKey | RRULHDKUPDTWQH-VIFPVBQESA-N |
| XLogP | 3.35 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|