C18H14N2O9 — CID 126090868
dimethyl 2-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]propanedioate (PubChem CID 126090868) has the molecular formula C18H14N2O9 and a molecular weight of 402.32 g/mol. Its IUPAC name is dimethyl 2-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 126090868 |
| Molecular Formula | C18H14N2O9 |
| Molecular Weight | 402.32 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | dimethyl 2-[[3-(2,4-dinitrophenoxy)phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1)C(=O)OC |
| InChI | InChI=1S/C18H14N2O9/c1-27-17(21)14(18(22)28-2)9-11-4-3-5-13(8-11)29-16-7-6-12(19(23)24)10-15(16)20(25)26/h3-10H,1-2H3 |
| InChIKey | XJJDYZROFBJGLV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 148.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|