C23H16N4O6 — CID 126086052
(Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-(2-methylphenyl)prop-2-enamide (PubChem CID 126086052) has the molecular formula C23H16N4O6 and a molecular weight of 444.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-(2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126086052 |
| Molecular Formula | C23H16N4O6 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1NC(=O)/C(C#N)=C\c1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16N4O6/c1-15-5-2-3-8-20(15)25-23(28)17(14-24)11-16-6-4-7-19(12-16)33-22-10-9-18(26(29)30)13-21(22)27(31)32/h2-13H,1H3,(H,25,28)/b17-11- |
| InChIKey | LVESSRDVYIFQGG-BOPFTXTBSA-N |
| XLogP | 5.15 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|