C25H18F3N3O4 — CID 126096043
(Z)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide (PubChem CID 126096043) has the molecular formula C25H18F3N3O4 and a molecular weight of 481.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126096043 |
| Molecular Formula | C25H18F3N3O4 |
| Molecular Weight | 481.43 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C25H18F3N3O4/c1-15-5-3-8-21(16(15)2)30-24(32)18(14-29)11-17-6-4-7-20(12-17)35-23-10-9-19(25(26,27)28)13-22(23)31(33)34/h3-13H,1-2H3,(H,30,32)/b18-11- |
| InChIKey | NLXATSFUYPIJRG-WQRHYEAKSA-N |
| XLogP | 6.57 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.43 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|