C22H14N4O6 — CID 126090760
(Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-phenylprop-2-enamide (PubChem CID 126090760) has the molecular formula C22H14N4O6 and a molecular weight of 430.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-phenylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 126090760 |
| Molecular Formula | C22H14N4O6 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (Z)-2-cyano-3-[3-(2,4-dinitrophenoxy)phenyl]-N-phenylprop-2-enamide |
| SMILES | N#C/C(=C/c1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H14N4O6/c23-14-16(22(27)24-17-6-2-1-3-7-17)11-15-5-4-8-19(12-15)32-21-10-9-18(25(28)29)13-20(21)26(30)31/h1-13H,(H,24,27)/b16-11- |
| InChIKey | BMWGITQFVBDAHK-WJDWOHSUSA-N |
| XLogP | 4.84 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|