C24H18N4O7 — CID 93012127
(Z)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-phenylprop-2-enamide (PubChem CID 93012127) has the molecular formula C24H18N4O7 and a molecular weight of 474.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-phenylprop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-phenylprop-2-enamide |
|---|---|
| PubChem CID | 93012127 |
| Molecular Formula | C24H18N4O7 |
| Molecular Weight | 474.43 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]-N-phenylprop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccccc2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H18N4O7/c1-2-34-23-13-16(12-17(15-25)24(29)26-18-6-4-3-5-7-18)8-10-22(23)35-21-11-9-19(27(30)31)14-20(21)28(32)33/h3-14H,2H2,1H3,(H,26,29)/b17-12- |
| InChIKey | PDKIRUJCOGNGMW-ATVHPVEESA-N |
| XLogP | 5.24 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|