C23H15BrN4O6 — CID 5209209
3-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide (PubChem CID 5209209) has the molecular formula C23H15BrN4O6 and a molecular weight of 523.30 g/mol. Its IUPAC name is 3-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5209209 |
| Molecular Formula | C23H15BrN4O6 |
| Molecular Weight | 523.30 g/mol |
| Exact Mass | 522.02 |
| IUPAC Name | 3-[3-bromo-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)C(C#N)=Cc2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Br)c2)c1 |
| InChI | InChI=1S/C23H15BrN4O6/c1-14-3-2-4-17(9-14)26-23(29)16(13-25)10-15-5-7-21(19(24)11-15)34-22-8-6-18(27(30)31)12-20(22)28(32)33/h2-12H,1H3,(H,26,29) |
| InChIKey | OBMUJCDOYAAVMN-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.30 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|