C23H14BrClN4O7 — CID 126090444
(E)-3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 126090444) has the molecular formula C23H14BrClN4O7 and a molecular weight of 573.74 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 126090444 |
| Molecular Formula | C23H14BrClN4O7 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 571.97 |
| IUPAC Name | (E)-3-[3-bromo-4-(2,4-dinitrophenoxy)-5-methoxyphenyl]-N-(3-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(Cl)c2)cc(Br)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H14BrClN4O7/c1-35-21-9-13(7-14(12-26)23(30)27-16-4-2-3-15(25)10-16)8-18(24)22(21)36-20-6-5-17(28(31)32)11-19(20)29(33)34/h2-11H,1H3,(H,27,30)/b14-7+ |
| InChIKey | PCNPZXQGGCCXEW-VGOFMYFVSA-N |
| XLogP | 6.27 |
| TPSA | 157.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|