C22H12ClN5O8 — CID 126088398
(E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126088398) has the molecular formula C22H12ClN5O8 and a molecular weight of 509.82 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126088398 |
| Molecular Formula | C22H12ClN5O8 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(Cl)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H12ClN5O8/c23-18-9-13(8-14(12-24)22(29)25-15-2-1-3-16(10-15)26(30)31)4-6-20(18)36-21-7-5-17(27(32)33)11-19(21)28(34)35/h1-11H,(H,25,29)/b14-8+ |
| InChIKey | RHJVFXTVSMMRCN-RIYZIHGNSA-N |
| XLogP | 5.40 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|