C23H15ClN4O6 — CID 126094656
(E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 126094656) has the molecular formula C23H15ClN4O6 and a molecular weight of 478.85 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126094656 |
| Molecular Formula | C23H15ClN4O6 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | (E)-3-[3-chloro-4-(2,4-dinitrophenoxy)phenyl]-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2ccc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H15ClN4O6/c1-14-2-5-17(6-3-14)26-23(29)16(13-25)10-15-4-8-21(19(24)11-15)34-22-9-7-18(27(30)31)12-20(22)28(32)33/h2-12H,1H3,(H,26,29)/b16-10+ |
| InChIKey | WRJSUHBDOVVQTB-MHWRWJLKSA-N |
| XLogP | 5.80 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|